C26H33N5O4 — CID 71459386
benzyl N-[(2S)-1-oxo-6-(prop-2-enoylamino)-1-(4-pyridin-2-ylpiperazin-1-yl)hexan-2-yl]carbamate (PubChem CID 71459386) has the molecular formula C26H33N5O4 and a molecular weight of 479.58 g/mol. Its IUPAC name is benzyl N-[(2S)-1-oxo-6-(prop-2-enoylamino)-1-(4-pyridin-2-ylpiperazin-1-yl)hexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-oxo-6-(prop-2-enoylamino)-1-(4-pyridin-2-ylpiperazin-1-yl)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 71459386 |
| Molecular Formula | C26H33N5O4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | benzyl N-[(2S)-1-oxo-6-(prop-2-enoylamino)-1-(4-pyridin-2-ylpiperazin-1-yl)hexan-2-yl]carbamate |
| SMILES | C=CC(=O)NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C26H33N5O4/c1-2-24(32)28-15-8-6-12-22(29-26(34)35-20-21-10-4-3-5-11-21)25(33)31-18-16-30(17-19-31)23-13-7-9-14-27-23/h2-5,7,9-11,13-14,22H,1,6,8,12,15-20H2,(H,28,32)(H,29,34)/t22-/m0/s1 |
| InChIKey | SGAVULBMEQPVHG-QFIPXVFZSA-N |
| XLogP | 2.50 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|