C22H31N3O4 — CID 71459380
benzyl N-[(2S)-1-oxo-1-piperidin-1-yl-6-(prop-2-enoylamino)hexan-2-yl]carbamate (PubChem CID 71459380) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is benzyl N-[(2S)-1-oxo-1-piperidin-1-yl-6-(prop-2-enoylamino)hexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-oxo-1-piperidin-1-yl-6-(prop-2-enoylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 71459380 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | benzyl N-[(2S)-1-oxo-1-piperidin-1-yl-6-(prop-2-enoylamino)hexan-2-yl]carbamate |
| SMILES | C=CC(=O)NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C22H31N3O4/c1-2-20(26)23-14-8-7-13-19(21(27)25-15-9-4-10-16-25)24-22(28)29-17-18-11-5-3-6-12-18/h2-3,5-6,11-12,19H,1,4,7-10,13-17H2,(H,23,26)(H,24,28)/t19-/m0/s1 |
| InChIKey | JWZGDCVVSRAFCT-IBGZPJMESA-N |
| XLogP | 2.77 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|