C27H33N3O9 — CID 102295934
(2S)-6-[[(4S)-4-carboxy-4-(phenylmethoxycarbonylamino)butanoyl]amino]-2-(phenylmethoxycarbonylamino)hexanoic acid (PubChem CID 102295934) has the molecular formula C27H33N3O9 and a molecular weight of 543.57 g/mol. Its IUPAC name is (2S)-6-[[(4S)-4-carboxy-4-(phenylmethoxycarbonylamino)butanoyl]amino]-2-(phenylmethoxycarbonylamino)hexanoic acid.
| Compound Name | (2S)-6-[[(4S)-4-carboxy-4-(phenylmethoxycarbonylamino)butanoyl]amino]-2-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 102295934 |
| Molecular Formula | C27H33N3O9 |
| Molecular Weight | 543.57 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | (2S)-6-[[(4S)-4-carboxy-4-(phenylmethoxycarbonylamino)butanoyl]amino]-2-(phenylmethoxycarbonylamino)hexanoic acid |
| SMILES | O=C(CC[C@H](NC(=O)OCc1ccccc1)C(=O)O)NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C27H33N3O9/c31-23(15-14-22(25(34)35)30-27(37)39-18-20-11-5-2-6-12-20)28-16-8-7-13-21(24(32)33)29-26(36)38-17-19-9-3-1-4-10-19/h1-6,9-12,21-22H,7-8,13-18H2,(H,28,31)(H,29,36)(H,30,37)(H,32,33)(H,34,35)/t21-,22-/m0/s1 |
| InChIKey | IBXXYPNDYXZFRR-VXKWHMMOSA-N |
| XLogP | 2.81 |
| TPSA | 180.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.57 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|