C23H34N4O7S2 — CID 10580148
(2S)-2-(phenylmethoxycarbonylamino)-6-[[4-[(2-sulfanylacetyl)amino]-3-[[(2-sulfanylacetyl)amino]methyl]butanoyl]amino]hexanoic acid (PubChem CID 10580148) has the molecular formula C23H34N4O7S2 and a molecular weight of 542.68 g/mol. Its IUPAC name is (2S)-2-(phenylmethoxycarbonylamino)-6-[[4-[(2-sulfanylacetyl)amino]-3-[[(2-sulfanylacetyl)amino]methyl]butanoyl]amino]hexanoic acid.
| Compound Name | (2S)-2-(phenylmethoxycarbonylamino)-6-[[4-[(2-sulfanylacetyl)amino]-3-[[(2-sulfanylacetyl)amino]methyl]butanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 10580148 |
| Molecular Formula | C23H34N4O7S2 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | (2S)-2-(phenylmethoxycarbonylamino)-6-[[4-[(2-sulfanylacetyl)amino]-3-[[(2-sulfanylacetyl)amino]methyl]butanoyl]amino]hexanoic acid |
| SMILES | O=C(CS)NCC(CNC(=O)CS)CC(=O)NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H34N4O7S2/c28-19(10-17(11-25-20(29)14-35)12-26-21(30)15-36)24-9-5-4-8-18(22(31)32)27-23(33)34-13-16-6-2-1-3-7-16/h1-3,6-7,17-18,35-36H,4-5,8-15H2,(H,24,28)(H,25,29)(H,26,30)(H,27,33)(H,31,32)/t18-/m0/s1 |
| InChIKey | NSQXVTKRLOCFOQ-SFHVURJKSA-N |
| XLogP | 0.75 |
| TPSA | 162.93 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|