C18H24N2O8 — CID 159507037
2-[[(1S)-1-carboxy-5-(phenylmethoxycarbonylamino)pentyl]amino]butanedioic acid (PubChem CID 159507037) has the molecular formula C18H24N2O8 and a molecular weight of 396.40 g/mol. Its IUPAC name is 2-[[(1S)-1-carboxy-5-(phenylmethoxycarbonylamino)pentyl]amino]butanedioic acid.
| Compound Name | 2-[[(1S)-1-carboxy-5-(phenylmethoxycarbonylamino)pentyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 159507037 |
| Molecular Formula | C18H24N2O8 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2-[[(1S)-1-carboxy-5-(phenylmethoxycarbonylamino)pentyl]amino]butanedioic acid |
| SMILES | O=C(O)CC(N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C18H24N2O8/c21-15(22)10-14(17(25)26)20-13(16(23)24)8-4-5-9-19-18(27)28-11-12-6-2-1-3-7-12/h1-3,6-7,13-14,20H,4-5,8-11H2,(H,19,27)(H,21,22)(H,23,24)(H,25,26)/t13-,14?/m0/s1 |
| InChIKey | WYJUZXLQFVJTAD-LSLKUGRBSA-N |
| XLogP | 1.05 |
| TPSA | 162.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|