C20H30N2O6S — CID 113236013
4-[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl]sulfanyl-2-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 113236013) has the molecular formula C20H30N2O6S and a molecular weight of 426.54 g/mol. Its IUPAC name is 4-[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl]sulfanyl-2-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | 4-[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl]sulfanyl-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 113236013 |
| Molecular Formula | C20H30N2O6S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 4-[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl]sulfanyl-2-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | CC(C)OCCCNC(=O)CSCCC(NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H30N2O6S/c1-15(2)27-11-6-10-21-18(23)14-29-12-9-17(19(24)25)22-20(26)28-13-16-7-4-3-5-8-16/h3-5,7-8,15,17H,6,9-14H2,1-2H3,(H,21,23)(H,22,26)(H,24,25) |
| InChIKey | KYOUMIIUJLVUCO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|