C18H27NO6S — CID 103180018
4-[2-(3-methoxypropoxy)ethylsulfanyl]-2-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 103180018) has the molecular formula C18H27NO6S and a molecular weight of 385.48 g/mol. Its IUPAC name is 4-[2-(3-methoxypropoxy)ethylsulfanyl]-2-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | 4-[2-(3-methoxypropoxy)ethylsulfanyl]-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 103180018 |
| Molecular Formula | C18H27NO6S |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 4-[2-(3-methoxypropoxy)ethylsulfanyl]-2-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | COCCCOCCSCCC(NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H27NO6S/c1-23-9-5-10-24-11-13-26-12-8-16(17(20)21)19-18(22)25-14-15-6-3-2-4-7-15/h2-4,6-7,16H,5,8-14H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | MKVAZSSAPBPJES-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|