C18H23N3O4S — CID 103002945
4-[2-(1-methylpyrazol-4-yl)ethylsulfanyl]-2-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 103002945) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is 4-[2-(1-methylpyrazol-4-yl)ethylsulfanyl]-2-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | 4-[2-(1-methylpyrazol-4-yl)ethylsulfanyl]-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 103002945 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 4-[2-(1-methylpyrazol-4-yl)ethylsulfanyl]-2-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | Cn1cc(CCSCCC(NC(=O)OCc2ccccc2)C(=O)O)cn1 |
| InChI | InChI=1S/C18H23N3O4S/c1-21-12-15(11-19-21)7-9-26-10-8-16(17(22)23)20-18(24)25-13-14-5-3-2-4-6-14/h2-6,11-12,16H,7-10,13H2,1H3,(H,20,24)(H,22,23) |
| InChIKey | YZDRBFPQDLIATN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|