C14H17N5O4S — CID 107043239
3-[(2-methyltetrazol-5-yl)methylsulfanyl]-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 107043239) has the molecular formula C14H17N5O4S and a molecular weight of 351.39 g/mol. Its IUPAC name is 3-[(2-methyltetrazol-5-yl)methylsulfanyl]-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-[(2-methyltetrazol-5-yl)methylsulfanyl]-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 107043239 |
| Molecular Formula | C14H17N5O4S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 3-[(2-methyltetrazol-5-yl)methylsulfanyl]-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | Cn1nnc(CSCC(NC(=O)OCc2ccccc2)C(=O)O)n1 |
| InChI | InChI=1S/C14H17N5O4S/c1-19-17-12(16-18-19)9-24-8-11(13(20)21)15-14(22)23-7-10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3,(H,15,22)(H,20,21) |
| InChIKey | PGKMNFTZFLLVIM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |