C16H19N5O6 — CID 139752997
methyl 5-[(3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]tetrazole-2-carboxylate (PubChem CID 139752997) has the molecular formula C16H19N5O6 and a molecular weight of 377.36 g/mol. Its IUPAC name is methyl 5-[(3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]tetrazole-2-carboxylate.
| Compound Name | methyl 5-[(3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]tetrazole-2-carboxylate |
|---|---|
| PubChem CID | 139752997 |
| Molecular Formula | C16H19N5O6 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | methyl 5-[(3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]tetrazole-2-carboxylate |
| SMILES | COC(=O)[C@H](CCc1nnn(C(=O)OC)n1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H19N5O6/c1-25-14(22)12(8-9-13-18-20-21(19-13)16(24)26-2)17-15(23)27-10-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3,(H,17,23)/t12-/m0/s1 |
| InChIKey | YMQHAPCJYOEBDD-LBPRGKRZSA-N |
| XLogP | 0.69 |
| TPSA | 134.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|