C20H23NO5 — CID 166446758
methyl 5-hydroxy-5-phenyl-2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 166446758) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is methyl 5-hydroxy-5-phenyl-2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | methyl 5-hydroxy-5-phenyl-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 166446758 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | methyl 5-hydroxy-5-phenyl-2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | COC(=O)C(CCC(O)c1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H23NO5/c1-25-19(23)17(12-13-18(22)16-10-6-3-7-11-16)21-20(24)26-14-15-8-4-2-5-9-15/h2-11,17-18,22H,12-14H2,1H3,(H,21,24) |
| InChIKey | PZPZDEGBCAYCGT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |