C18H27NO5S — CID 103033885
4-(3-methoxy-3-methylbutyl)sulfanyl-2-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 103033885) has the molecular formula C18H27NO5S and a molecular weight of 369.48 g/mol. Its IUPAC name is 4-(3-methoxy-3-methylbutyl)sulfanyl-2-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | 4-(3-methoxy-3-methylbutyl)sulfanyl-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 103033885 |
| Molecular Formula | C18H27NO5S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 4-(3-methoxy-3-methylbutyl)sulfanyl-2-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | COC(C)(C)CCSCCC(NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H27NO5S/c1-18(2,23-3)10-12-25-11-9-15(16(20)21)19-17(22)24-13-14-7-5-4-6-8-14/h4-8,15H,9-13H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | IYMQEGHOKSTUHB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|