C14H14F5NO4 — CID 90115911
(2S)-5,5,6,6,6-pentafluoro-2-(phenylmethoxycarbonylamino)hexanoic acid (PubChem CID 90115911) has the molecular formula C14H14F5NO4 and a molecular weight of 355.26 g/mol. Its IUPAC name is (2S)-5,5,6,6,6-pentafluoro-2-(phenylmethoxycarbonylamino)hexanoic acid.
| Compound Name | (2S)-5,5,6,6,6-pentafluoro-2-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 90115911 |
| Molecular Formula | C14H14F5NO4 |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | (2S)-5,5,6,6,6-pentafluoro-2-(phenylmethoxycarbonylamino)hexanoic acid |
| SMILES | O=C(N[C@@H](CCC(F)(F)C(F)(F)F)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C14H14F5NO4/c15-13(16,14(17,18)19)7-6-10(11(21)22)20-12(23)24-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,20,23)(H,21,22)/t10-/m0/s1 |
| InChIKey | BZBJCKDQCMOXCS-JTQLQIEISA-N |
| XLogP | 3.34 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|