C15H16F5NO7S — CID 175348200
(2S)-5,5-difluoro-2-(phenylmethoxycarbonylamino)-6-(trifluoromethylsulfonyloxy)hexanoic acid (PubChem CID 175348200) has the molecular formula C15H16F5NO7S and a molecular weight of 449.35 g/mol. Its IUPAC name is (2S)-5,5-difluoro-2-(phenylmethoxycarbonylamino)-6-(trifluoromethylsulfonyloxy)hexanoic acid.
| Compound Name | (2S)-5,5-difluoro-2-(phenylmethoxycarbonylamino)-6-(trifluoromethylsulfonyloxy)hexanoic acid |
|---|---|
| PubChem CID | 175348200 |
| Molecular Formula | C15H16F5NO7S |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | (2S)-5,5-difluoro-2-(phenylmethoxycarbonylamino)-6-(trifluoromethylsulfonyloxy)hexanoic acid |
| SMILES | O=C(N[C@@H](CCC(F)(F)COS(=O)(=O)C(F)(F)F)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C15H16F5NO7S/c16-14(17,9-28-29(25,26)15(18,19)20)7-6-11(12(22)23)21-13(24)27-8-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,21,24)(H,22,23)/t11-/m0/s1 |
| InChIKey | WAKFUNNKKQJATD-NSHDSACASA-N |
| XLogP | 2.65 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|