C15H21NO6 — CID 103668903
4-(2-methoxyethoxy)-2-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 103668903) has the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-2-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | 4-(2-methoxyethoxy)-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 103668903 |
| Molecular Formula | C15H21NO6 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 4-(2-methoxyethoxy)-2-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | COCCOCCC(NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H21NO6/c1-20-9-10-21-8-7-13(14(17)18)16-15(19)22-11-12-5-3-2-4-6-12/h2-6,13H,7-11H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | YNSDGGZRHWYOJO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|