C19H28N2O6S — CID 70452406
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[1-(phenylmethoxycarbonylamino)ethylsulfanyl]butanoic acid (PubChem CID 70452406) has the molecular formula C19H28N2O6S and a molecular weight of 412.51 g/mol. Its IUPAC name is (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[1-(phenylmethoxycarbonylamino)ethylsulfanyl]butanoic acid.
| Compound Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[1-(phenylmethoxycarbonylamino)ethylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 70452406 |
| Molecular Formula | C19H28N2O6S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[1-(phenylmethoxycarbonylamino)ethylsulfanyl]butanoic acid |
| SMILES | CC(NC(=O)OCc1ccccc1)SCC[C@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C19H28N2O6S/c1-13(20-17(24)26-12-14-8-6-5-7-9-14)28-11-10-15(16(22)23)21-18(25)27-19(2,3)4/h5-9,13,15H,10-12H2,1-4H3,(H,20,24)(H,21,25)(H,22,23)/t13?,15-/m0/s1 |
| InChIKey | QTYZTIJNNYEPOT-WUJWULDRSA-N |
| XLogP | 3.36 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|