C17H23NO6 — CID 71289865
5-butoxy-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 71289865) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is 5-butoxy-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | 5-butoxy-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 71289865 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 5-butoxy-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | CCCCOC(=O)CCC(NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H23NO6/c1-2-3-11-23-15(19)10-9-14(16(20)21)18-17(22)24-12-13-7-5-4-6-8-13/h4-8,14H,2-3,9-12H2,1H3,(H,18,22)(H,20,21) |
| InChIKey | DPKAFSMEAASBDP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|