C18H26N2O6S — CID 70169586
3-(1-amino-3-oxo-3-phenylmethoxypropyl)sulfanyl-2-(butoxycarbonylamino)propanoic acid (PubChem CID 70169586) has the molecular formula C18H26N2O6S and a molecular weight of 398.48 g/mol. Its IUPAC name is 3-(1-amino-3-oxo-3-phenylmethoxypropyl)sulfanyl-2-(butoxycarbonylamino)propanoic acid.
| Compound Name | 3-(1-amino-3-oxo-3-phenylmethoxypropyl)sulfanyl-2-(butoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 70169586 |
| Molecular Formula | C18H26N2O6S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 3-(1-amino-3-oxo-3-phenylmethoxypropyl)sulfanyl-2-(butoxycarbonylamino)propanoic acid |
| SMILES | CCCCOC(=O)NC(CSC(N)CC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H26N2O6S/c1-2-3-9-25-18(24)20-14(17(22)23)12-27-15(19)10-16(21)26-11-13-7-5-4-6-8-13/h4-8,14-15H,2-3,9-12,19H2,1H3,(H,20,24)(H,22,23) |
| InChIKey | CNWLKWDZDLZMGM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|