C30H33NO6 — CID 69143266
dibenzyl 2-(butoxycarbonylamino)-3-phenylpentanedioate (PubChem CID 69143266) has the molecular formula C30H33NO6 and a molecular weight of 503.60 g/mol. Its IUPAC name is dibenzyl 2-(butoxycarbonylamino)-3-phenylpentanedioate.
| Compound Name | dibenzyl 2-(butoxycarbonylamino)-3-phenylpentanedioate |
|---|---|
| PubChem CID | 69143266 |
| Molecular Formula | C30H33NO6 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | dibenzyl 2-(butoxycarbonylamino)-3-phenylpentanedioate |
| SMILES | CCCCOC(=O)NC(C(=O)OCc1ccccc1)C(CC(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H33NO6/c1-2-3-19-35-30(34)31-28(29(33)37-22-24-15-9-5-10-16-24)26(25-17-11-6-12-18-25)20-27(32)36-21-23-13-7-4-8-14-23/h4-18,26,28H,2-3,19-22H2,1H3,(H,31,34) |
| InChIKey | ZBRMEABKGPUQGQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|