C17H25NO5 — CID 151158685
benzyl (3S)-3-(butoxycarbonylamino)-4-methoxybutanoate (PubChem CID 151158685) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is benzyl (3S)-3-(butoxycarbonylamino)-4-methoxybutanoate.
| Compound Name | benzyl (3S)-3-(butoxycarbonylamino)-4-methoxybutanoate |
|---|---|
| PubChem CID | 151158685 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | benzyl (3S)-3-(butoxycarbonylamino)-4-methoxybutanoate |
| SMILES | CCCCOC(=O)N[C@H](COC)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H25NO5/c1-3-4-10-22-17(20)18-15(13-21-2)11-16(19)23-12-14-8-6-5-7-9-14/h5-9,15H,3-4,10-13H2,1-2H3,(H,18,20)/t15-/m0/s1 |
| InChIKey | MZUJEXWAIUPYNG-HNNXBMFYSA-N |
| XLogP | 2.66 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|