C20H21NO6 — CID 131859948
5-oxo-5-phenylmethoxy-3-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 131859948) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is 5-oxo-5-phenylmethoxy-3-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | 5-oxo-5-phenylmethoxy-3-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 131859948 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 5-oxo-5-phenylmethoxy-3-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | O=C(O)CC(CC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H21NO6/c22-18(23)11-17(12-19(24)26-13-15-7-3-1-4-8-15)21-20(25)27-14-16-9-5-2-6-10-16/h1-10,17H,11-14H2,(H,21,25)(H,22,23) |
| InChIKey | ZRFLQGYWVYGXNY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |