C15H23N2O4+ — CID 13393135
[(2R)-3-carboxy-2-(phenylmethoxycarbonylamino)propyl]-trimethylazanium (PubChem CID 13393135) has the molecular formula C15H23N2O4+ and a molecular weight of 295.36 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-(phenylmethoxycarbonylamino)propyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-2-(phenylmethoxycarbonylamino)propyl]-trimethylazanium |
|---|---|
| PubChem CID | 13393135 |
| Molecular Formula | C15H23N2O4+ |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | [(2R)-3-carboxy-2-(phenylmethoxycarbonylamino)propyl]-trimethylazanium |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H22N2O4/c1-17(2,3)10-13(9-14(18)19)16-15(20)21-11-12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3,(H-,16,18,19,20)/p+1/t13-/m1/s1 |
| InChIKey | YDPNHEPKFBNVAV-CYBMUJFWSA-O |
| XLogP | 1.46 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|