C21H28N3O4+ — CID 25065916
[(2R)-3-carboxy-2-[(4-phenylmethoxyphenyl)carbamoylamino]propyl]-trimethylazanium (PubChem CID 25065916) has the molecular formula C21H28N3O4+ and a molecular weight of 386.47 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[(4-phenylmethoxyphenyl)carbamoylamino]propyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-2-[(4-phenylmethoxyphenyl)carbamoylamino]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 25065916 |
| Molecular Formula | C21H28N3O4+ |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | [(2R)-3-carboxy-2-[(4-phenylmethoxyphenyl)carbamoylamino]propyl]-trimethylazanium |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)O)NC(=O)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H27N3O4/c1-24(2,3)14-18(13-20(25)26)23-21(27)22-17-9-11-19(12-10-17)28-15-16-7-5-4-6-8-16/h4-12,18H,13-15H2,1-3H3,(H2-,22,23,25,26,27)/p+1/t18-/m1/s1 |
| InChIKey | OERKXRJOLQPDBJ-GOSISDBHSA-O |
| XLogP | 2.94 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|