C22H29N3O5 — CID 58005209
(3R)-3-[(4-methoxy-3-phenylmethoxyphenyl)carbamoylamino]-4-(trimethylazaniumyl)butanoate (PubChem CID 58005209) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is (3R)-3-[(4-methoxy-3-phenylmethoxyphenyl)carbamoylamino]-4-(trimethylazaniumyl)butanoate.
| Compound Name | (3R)-3-[(4-methoxy-3-phenylmethoxyphenyl)carbamoylamino]-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 58005209 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | (3R)-3-[(4-methoxy-3-phenylmethoxyphenyl)carbamoylamino]-4-(trimethylazaniumyl)butanoate |
| SMILES | COc1ccc(NC(=O)N[C@H](CC(=O)[O-])C[N+](C)(C)C)cc1OCc1ccccc1 |
| InChI | InChI=1S/C22H29N3O5/c1-25(2,3)14-18(13-21(26)27)24-22(28)23-17-10-11-19(29-4)20(12-17)30-15-16-8-6-5-7-9-16/h5-12,18H,13-15H2,1-4H3,(H2-,23,24,26,27,28)/t18-/m1/s1 |
| InChIKey | DKJVMKXNHZLKIK-GOSISDBHSA-N |
| XLogP | 1.61 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|