C23H24N4O4 — CID 55683457
N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]-2-(phenylcarbamoylamino)propanamide (PubChem CID 55683457) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]-2-(phenylcarbamoylamino)propanamide.
| Compound Name | N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]-2-(phenylcarbamoylamino)propanamide |
|---|---|
| PubChem CID | 55683457 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]-2-(phenylcarbamoylamino)propanamide |
| SMILES | COc1ccc(NC(=O)C(C)NC(=O)Nc2ccccc2)cc1OCc1cccnc1 |
| InChI | InChI=1S/C23H24N4O4/c1-16(25-23(29)27-18-8-4-3-5-9-18)22(28)26-19-10-11-20(30-2)21(13-19)31-15-17-7-6-12-24-14-17/h3-14,16H,15H2,1-2H3,(H,26,28)(H2,25,27,29) |
| InChIKey | UCRVNNLAEUAQLZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |