C20H15ClF2N2O3 — CID 55643410
2-chloro-4,5-difluoro-N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]benzamide (PubChem CID 55643410) has the molecular formula C20H15ClF2N2O3 and a molecular weight of 404.80 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]benzamide.
| Compound Name | 2-chloro-4,5-difluoro-N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 55643410 |
| Molecular Formula | C20H15ClF2N2O3 |
| Molecular Weight | 404.80 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]benzamide |
| SMILES | COc1ccc(NC(=O)c2cc(F)c(F)cc2Cl)cc1OCc1cccnc1 |
| InChI | InChI=1S/C20H15ClF2N2O3/c1-27-18-5-4-13(7-19(18)28-11-12-3-2-6-24-10-12)25-20(26)14-8-16(22)17(23)9-15(14)21/h2-10H,11H2,1H3,(H,25,26) |
| InChIKey | JTUMPSTYNOTUNN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.80 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|