C18H23N3O4 — CID 120595348
4-amino-3-methoxy-N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]butanamide (PubChem CID 120595348) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]butanamide.
| Compound Name | 4-amino-3-methoxy-N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 120595348 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 4-amino-3-methoxy-N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]butanamide |
| SMILES | COc1ccc(NC(=O)CC(CN)OC)cc1OCc1cccnc1 |
| InChI | InChI=1S/C18H23N3O4/c1-23-15(10-19)9-18(22)21-14-5-6-16(24-2)17(8-14)25-12-13-4-3-7-20-11-13/h3-8,11,15H,9-10,12,19H2,1-2H3,(H,21,22) |
| InChIKey | QYORDVARCPVYQY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |