C22H30N3O5+ — CID 58005210
[(2R)-3-carboxy-2-[(4-methoxy-3-phenylmethoxyphenyl)carbamoylamino]propyl]-trimethylazanium (PubChem CID 58005210) has the molecular formula C22H30N3O5+ and a molecular weight of 416.50 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[(4-methoxy-3-phenylmethoxyphenyl)carbamoylamino]propyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-2-[(4-methoxy-3-phenylmethoxyphenyl)carbamoylamino]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 58005210 |
| Molecular Formula | C22H30N3O5+ |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | [(2R)-3-carboxy-2-[(4-methoxy-3-phenylmethoxyphenyl)carbamoylamino]propyl]-trimethylazanium |
| SMILES | COc1ccc(NC(=O)N[C@H](CC(=O)O)C[N+](C)(C)C)cc1OCc1ccccc1 |
| InChI | InChI=1S/C22H29N3O5/c1-25(2,3)14-18(13-21(26)27)24-22(28)23-17-10-11-19(29-4)20(12-17)30-15-16-8-6-5-7-9-16/h5-12,18H,13-15H2,1-4H3,(H2-,23,24,26,27,28)/p+1/t18-/m1/s1 |
| InChIKey | DKJVMKXNHZLKIK-GOSISDBHSA-O |
| XLogP | 2.95 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|