C27H40N3O4+ — CID 44629010
[(2R)-3-carboxy-2-[7-(4-phenylphenoxy)heptylcarbamoylamino]propyl]-trimethylazanium (PubChem CID 44629010) has the molecular formula C27H40N3O4+ and a molecular weight of 470.63 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[7-(4-phenylphenoxy)heptylcarbamoylamino]propyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-2-[7-(4-phenylphenoxy)heptylcarbamoylamino]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 44629010 |
| Molecular Formula | C27H40N3O4+ |
| Molecular Weight | 470.63 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | [(2R)-3-carboxy-2-[7-(4-phenylphenoxy)heptylcarbamoylamino]propyl]-trimethylazanium |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)O)NC(=O)NCCCCCCCOc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H39N3O4/c1-30(2,3)21-24(20-26(31)32)29-27(33)28-18-10-5-4-6-11-19-34-25-16-14-23(15-17-25)22-12-8-7-9-13-22/h7-9,12-17,24H,4-6,10-11,18-21H2,1-3H3,(H2-,28,29,31,32,33)/p+1/t24-/m1/s1 |
| InChIKey | WCYRXLAEXMNLGG-XMMPIXPASA-O |
| XLogP | 4.53 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.63 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|