C17H27N2O4+ — CID 68742952
[3-carboxy-2-[(4-propoxybenzoyl)amino]propyl]-trimethylazanium (PubChem CID 68742952) has the molecular formula C17H27N2O4+ and a molecular weight of 323.41 g/mol. Its IUPAC name is [3-carboxy-2-[(4-propoxybenzoyl)amino]propyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[(4-propoxybenzoyl)amino]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 68742952 |
| Molecular Formula | C17H27N2O4+ |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | [3-carboxy-2-[(4-propoxybenzoyl)amino]propyl]-trimethylazanium |
| SMILES | CCCOc1ccc(C(=O)NC(CC(=O)O)C[N+](C)(C)C)cc1 |
| InChI | InChI=1S/C17H26N2O4/c1-5-10-23-15-8-6-13(7-9-15)17(22)18-14(11-16(20)21)12-19(2,3)4/h6-9,14H,5,10-12H2,1-4H3,(H-,18,20,21,22)/p+1 |
| InChIKey | MOUUVDKBXBFFDL-UHFFFAOYSA-O |
| XLogP | 1.75 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|