C23H39N3O5 — CID 24810828
3-[3-(3-hexoxyphenoxy)propylcarbamoylamino]-4-(trimethylazaniumyl)butanoate (PubChem CID 24810828) has the molecular formula C23H39N3O5 and a molecular weight of 437.58 g/mol. Its IUPAC name is 3-[3-(3-hexoxyphenoxy)propylcarbamoylamino]-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[3-(3-hexoxyphenoxy)propylcarbamoylamino]-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 24810828 |
| Molecular Formula | C23H39N3O5 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | 3-[3-(3-hexoxyphenoxy)propylcarbamoylamino]-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCCCCOc1cccc(OCCCNC(=O)NC(CC(=O)[O-])C[N+](C)(C)C)c1 |
| InChI | InChI=1S/C23H39N3O5/c1-5-6-7-8-14-30-20-11-9-12-21(17-20)31-15-10-13-24-23(29)25-19(16-22(27)28)18-26(2,3)4/h9,11-12,17,19H,5-8,10,13-16,18H2,1-4H3,(H2-,24,25,27,28,29) |
| InChIKey | YSBCFGOEUWWDSI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|