C25H46N3O6S+ — CID 68741933
[3-carboxy-2-[5-(3-hexoxyphenoxy)pentyl-(methylsulfamoyl)amino]propyl]-trimethylazanium (PubChem CID 68741933) has the molecular formula C25H46N3O6S+ and a molecular weight of 516.73 g/mol. Its IUPAC name is [3-carboxy-2-[5-(3-hexoxyphenoxy)pentyl-(methylsulfamoyl)amino]propyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[5-(3-hexoxyphenoxy)pentyl-(methylsulfamoyl)amino]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 68741933 |
| Molecular Formula | C25H46N3O6S+ |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | [3-carboxy-2-[5-(3-hexoxyphenoxy)pentyl-(methylsulfamoyl)amino]propyl]-trimethylazanium |
| SMILES | CCCCCCOc1cccc(OCCCCCN(C(CC(=O)O)C[N+](C)(C)C)S(=O)(=O)NC)c1 |
| InChI | InChI=1S/C25H45N3O6S/c1-6-7-8-11-17-33-23-14-13-15-24(20-23)34-18-12-9-10-16-27(35(31,32)26-2)22(19-25(29)30)21-28(3,4)5/h13-15,20,22,26H,6-12,16-19,21H2,1-5H3/p+1 |
| InChIKey | IDNRJAUILACHOE-UHFFFAOYSA-O |
| XLogP | 3.51 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|