C21H37NO8P+ — CID 22408078
[3-carboxy-2-[hydroxy-[3-(3-pentoxyphenoxy)propoxy]phosphoryl]oxypropyl]-trimethylazanium (PubChem CID 22408078) has the molecular formula C21H37NO8P+ and a molecular weight of 462.50 g/mol. Its IUPAC name is [3-carboxy-2-[hydroxy-[3-(3-pentoxyphenoxy)propoxy]phosphoryl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[hydroxy-[3-(3-pentoxyphenoxy)propoxy]phosphoryl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 22408078 |
| Molecular Formula | C21H37NO8P+ |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | [3-carboxy-2-[hydroxy-[3-(3-pentoxyphenoxy)propoxy]phosphoryl]oxypropyl]-trimethylazanium |
| SMILES | CCCCCOc1cccc(OCCCOP(=O)(O)OC(CC(=O)O)C[N+](C)(C)C)c1 |
| InChI | InChI=1S/C21H36NO8P/c1-5-6-7-12-27-18-10-8-11-19(15-18)28-13-9-14-29-31(25,26)30-20(16-21(23)24)17-22(2,3)4/h8,10-11,15,20H,5-7,9,12-14,16-17H2,1-4H3,(H-,23,24,25,26)/p+1 |
| InChIKey | FXFPUCIUTKHRRC-UHFFFAOYSA-O |
| XLogP | 3.71 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|