C23H33NO8P+ — CID 22407991
[3-carboxy-2-[hydroxy-[4-(4-phenoxyphenoxy)butoxy]phosphoryl]oxypropyl]-trimethylazanium (PubChem CID 22407991) has the molecular formula C23H33NO8P+ and a molecular weight of 482.49 g/mol. Its IUPAC name is [3-carboxy-2-[hydroxy-[4-(4-phenoxyphenoxy)butoxy]phosphoryl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[hydroxy-[4-(4-phenoxyphenoxy)butoxy]phosphoryl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 22407991 |
| Molecular Formula | C23H33NO8P+ |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | [3-carboxy-2-[hydroxy-[4-(4-phenoxyphenoxy)butoxy]phosphoryl]oxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(CC(=O)O)OP(=O)(O)OCCCCOc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H32NO8P/c1-24(2,3)18-22(17-23(25)26)32-33(27,28)30-16-8-7-15-29-19-11-13-21(14-12-19)31-20-9-5-4-6-10-20/h4-6,9-14,22H,7-8,15-18H2,1-3H3,(H-,25,26,27,28)/p+1 |
| InChIKey | BHDGBYCMTLCFNM-UHFFFAOYSA-O |
| XLogP | 4.32 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|