C23H42NO10P — CID 22408011
[3-carboxy-2-[hydroxy-[4-(3-methoxy-5-pentoxyphenoxy)butoxy]phosphoryl]oxypropyl]-trimethylazanium hydroxide (PubChem CID 22408011) has the molecular formula C23H42NO10P and a molecular weight of 523.56 g/mol. Its IUPAC name is [3-carboxy-2-[hydroxy-[4-(3-methoxy-5-pentoxyphenoxy)butoxy]phosphoryl]oxypropyl]-trimethylazanium hydroxide.
| Compound Name | [3-carboxy-2-[hydroxy-[4-(3-methoxy-5-pentoxyphenoxy)butoxy]phosphoryl]oxypropyl]-trimethylazanium hydroxide |
|---|---|
| PubChem CID | 22408011 |
| Molecular Formula | C23H42NO10P |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | [3-carboxy-2-[hydroxy-[4-(3-methoxy-5-pentoxyphenoxy)butoxy]phosphoryl]oxypropyl]-trimethylazanium hydroxide |
| SMILES | CCCCCOc1cc(OC)cc(OCCCCOP(=O)(O)OC(CC(=O)O)C[N+](C)(C)C)c1.[OH-] |
| InChI | InChI=1S/C23H40NO9P.H2O/c1-6-7-8-11-30-20-14-19(29-5)15-21(16-20)31-12-9-10-13-32-34(27,28)33-22(17-23(25)26)18-24(2,3)4;/h14-16,22H,6-13,17-18H2,1-5H3,(H-,25,26,27,28);1H2 |
| InChIKey | JYOVRIBNXQWMLU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 150.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|