C21H34Cl3NO7P+ — CID 15228437
[(2R)-3-carboxy-2-[hydroxy-[8-(2,3,4-trichlorophenoxy)octoxy]phosphoryl]oxypropyl]-trimethylazanium (PubChem CID 15228437) has the molecular formula C21H34Cl3NO7P+ and a molecular weight of 549.84 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[hydroxy-[8-(2,3,4-trichlorophenoxy)octoxy]phosphoryl]oxypropyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-2-[hydroxy-[8-(2,3,4-trichlorophenoxy)octoxy]phosphoryl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 15228437 |
| Molecular Formula | C21H34Cl3NO7P+ |
| Molecular Weight | 549.84 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | [(2R)-3-carboxy-2-[hydroxy-[8-(2,3,4-trichlorophenoxy)octoxy]phosphoryl]oxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)O)OP(=O)(O)OCCCCCCCCOc1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C21H33Cl3NO7P/c1-25(2,3)15-16(14-19(26)27)32-33(28,29)31-13-9-7-5-4-6-8-12-30-18-11-10-17(22)20(23)21(18)24/h10-11,16H,4-9,12-15H2,1-3H3,(H-,26,27,28,29)/p+1/t16-/m1/s1 |
| InChIKey | VFPWRIOHKKPZJX-MRXNPFEDSA-O |
| XLogP | 6.05 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.84 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|