C24H42NO9P — CID 22853431
[(2R)-2-[8-(4-acetyl-3-methylphenoxy)octoxy-hydroxyphosphoryl]oxy-3-carboxypropyl]-trimethylazanium hydroxide (PubChem CID 22853431) has the molecular formula C24H42NO9P and a molecular weight of 519.57 g/mol. Its IUPAC name is [(2R)-2-[8-(4-acetyl-3-methylphenoxy)octoxy-hydroxyphosphoryl]oxy-3-carboxypropyl]-trimethylazanium hydroxide.
| Compound Name | [(2R)-2-[8-(4-acetyl-3-methylphenoxy)octoxy-hydroxyphosphoryl]oxy-3-carboxypropyl]-trimethylazanium hydroxide |
|---|---|
| PubChem CID | 22853431 |
| Molecular Formula | C24H42NO9P |
| Molecular Weight | 519.57 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | [(2R)-2-[8-(4-acetyl-3-methylphenoxy)octoxy-hydroxyphosphoryl]oxy-3-carboxypropyl]-trimethylazanium hydroxide |
| SMILES | CC(=O)c1ccc(OCCCCCCCCOP(=O)(O)O[C@H](CC(=O)O)C[N+](C)(C)C)cc1C.[OH-] |
| InChI | InChI=1S/C24H40NO8P.H2O/c1-19-16-21(12-13-23(19)20(2)26)31-14-10-8-6-7-9-11-15-32-34(29,30)33-22(17-24(27)28)18-25(3,4)5;/h12-13,16,22H,6-11,14-15,17-18H2,1-5H3,(H-,27,28,29,30);1H2/t22-;/m1./s1 |
| InChIKey | PEWBZIORGSAZLM-VZYDHVRKSA-N |
| XLogP | 4.42 |
| TPSA | 149.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|