C22H37ClN2O8P+ — CID 67736739
[(2R)-3-carboxy-2-[6-[[2-(4-chlorophenoxy)acetyl]-methylamino]hexoxy-hydroxyphosphoryl]oxypropyl]-trimethylazanium (PubChem CID 67736739) has the molecular formula C22H37ClN2O8P+ and a molecular weight of 523.97 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[6-[[2-(4-chlorophenoxy)acetyl]-methylamino]hexoxy-hydroxyphosphoryl]oxypropyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-2-[6-[[2-(4-chlorophenoxy)acetyl]-methylamino]hexoxy-hydroxyphosphoryl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 67736739 |
| Molecular Formula | C22H37ClN2O8P+ |
| Molecular Weight | 523.97 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | [(2R)-3-carboxy-2-[6-[[2-(4-chlorophenoxy)acetyl]-methylamino]hexoxy-hydroxyphosphoryl]oxypropyl]-trimethylazanium |
| SMILES | CN(CCCCCCOP(=O)(O)O[C@H](CC(=O)O)C[N+](C)(C)C)C(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H36ClN2O8P/c1-24(21(26)17-31-19-11-9-18(23)10-12-19)13-7-5-6-8-14-32-34(29,30)33-20(15-22(27)28)16-25(2,3)4/h9-12,20H,5-8,13-17H2,1-4H3,(H-,27,28,29,30)/p+1/t20-/m1/s1 |
| InChIKey | QAOUJIJVNZWMMW-HXUWFJFHSA-O |
| XLogP | 3.42 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.97 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|