C22H37ClNO8P — CID 67736673
(2R)-2-[9-(4-chlorophenoxy)nonoxy-hydroxyphosphoryl]oxy-4-hydroxy-4-oxo-1-(trimethylazaniumyl)butan-1-olate (PubChem CID 67736673) has the molecular formula C22H37ClNO8P and a molecular weight of 509.96 g/mol. Its IUPAC name is (2R)-2-[9-(4-chlorophenoxy)nonoxy-hydroxyphosphoryl]oxy-4-hydroxy-4-oxo-1-(trimethylazaniumyl)butan-1-olate.
| Compound Name | (2R)-2-[9-(4-chlorophenoxy)nonoxy-hydroxyphosphoryl]oxy-4-hydroxy-4-oxo-1-(trimethylazaniumyl)butan-1-olate |
|---|---|
| PubChem CID | 67736673 |
| Molecular Formula | C22H37ClNO8P |
| Molecular Weight | 509.96 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | (2R)-2-[9-(4-chlorophenoxy)nonoxy-hydroxyphosphoryl]oxy-4-hydroxy-4-oxo-1-(trimethylazaniumyl)butan-1-olate |
| SMILES | C[N+](C)(C)C([O-])[C@@H](CC(=O)O)OP(=O)(O)OCCCCCCCCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H37ClNO8P/c1-24(2,3)22(27)20(17-21(25)26)32-33(28,29)31-16-10-8-6-4-5-7-9-15-30-19-13-11-18(23)12-14-19/h11-14,20,22H,4-10,15-17H2,1-3H3,(H,25,26)(H,28,29)/t20-,22?/m1/s1 |
| InChIKey | QPTHJCMMWHFZSO-PSDZMVHGSA-N |
| XLogP | 3.82 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.96 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|