C22H36F3NO9P+ — CID 67736680
[(2R)-3-carboxy-1-hydroxy-2-[hydroxy-[8-[4-(trifluoromethoxy)phenoxy]octoxy]phosphoryl]oxypropyl]-trimethylazanium (PubChem CID 67736680) has the molecular formula C22H36F3NO9P+ and a molecular weight of 546.50 g/mol. Its IUPAC name is [(2R)-3-carboxy-1-hydroxy-2-[hydroxy-[8-[4-(trifluoromethoxy)phenoxy]octoxy]phosphoryl]oxypropyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-1-hydroxy-2-[hydroxy-[8-[4-(trifluoromethoxy)phenoxy]octoxy]phosphoryl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 67736680 |
| Molecular Formula | C22H36F3NO9P+ |
| Molecular Weight | 546.50 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | [(2R)-3-carboxy-1-hydroxy-2-[hydroxy-[8-[4-(trifluoromethoxy)phenoxy]octoxy]phosphoryl]oxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)C(O)[C@@H](CC(=O)O)OP(=O)(O)OCCCCCCCCOc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C22H35F3NO9P/c1-26(2,3)21(29)19(16-20(27)28)35-36(30,31)33-15-9-7-5-4-6-8-14-32-17-10-12-18(13-11-17)34-22(23,24)25/h10-13,19,21,29H,4-9,14-16H2,1-3H3,(H-,27,28,30,31)/p+1/t19-,21?/m1/s1 |
| InChIKey | BSSCESXRMXXWFO-YMBRHYMPSA-O |
| XLogP | 4.31 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|