C22H39NO9P+ — CID 67736658
[(2R)-3-carboxy-1-hydroxy-2-[hydroxy-[4-(3-pentoxyphenoxy)butoxy]phosphoryl]oxypropyl]-trimethylazanium (PubChem CID 67736658) has the molecular formula C22H39NO9P+ and a molecular weight of 492.53 g/mol. Its IUPAC name is [(2R)-3-carboxy-1-hydroxy-2-[hydroxy-[4-(3-pentoxyphenoxy)butoxy]phosphoryl]oxypropyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-1-hydroxy-2-[hydroxy-[4-(3-pentoxyphenoxy)butoxy]phosphoryl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 67736658 |
| Molecular Formula | C22H39NO9P+ |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | [(2R)-3-carboxy-1-hydroxy-2-[hydroxy-[4-(3-pentoxyphenoxy)butoxy]phosphoryl]oxypropyl]-trimethylazanium |
| SMILES | CCCCCOc1cccc(OCCCCOP(=O)(O)O[C@H](CC(=O)O)C(O)[N+](C)(C)C)c1 |
| InChI | InChI=1S/C22H38NO9P/c1-5-6-7-13-29-18-11-10-12-19(16-18)30-14-8-9-15-31-33(27,28)32-20(17-21(24)25)22(26)23(2,3)4/h10-12,16,20,22,26H,5-9,13-15,17H2,1-4H3,(H-,24,25,27,28)/p+1/t20-,22?/m1/s1 |
| InChIKey | JEXODKAMYGPFBM-PSDZMVHGSA-O |
| XLogP | 3.42 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|