C24H37NO8P+ — CID 54461312
[(2R)-3-carboxy-2-[hydroxy-[4-(7-propoxynaphthalen-2-yl)oxybutoxy]phosphoryl]oxypropyl]-trimethylazanium (PubChem CID 54461312) has the molecular formula C24H37NO8P+ and a molecular weight of 498.53 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[hydroxy-[4-(7-propoxynaphthalen-2-yl)oxybutoxy]phosphoryl]oxypropyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-2-[hydroxy-[4-(7-propoxynaphthalen-2-yl)oxybutoxy]phosphoryl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 54461312 |
| Molecular Formula | C24H37NO8P+ |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | [(2R)-3-carboxy-2-[hydroxy-[4-(7-propoxynaphthalen-2-yl)oxybutoxy]phosphoryl]oxypropyl]-trimethylazanium |
| SMILES | CCCOc1ccc2ccc(OCCCCOP(=O)(O)O[C@H](CC(=O)O)C[N+](C)(C)C)cc2c1 |
| InChI | InChI=1S/C24H36NO8P/c1-5-12-30-21-10-8-19-9-11-22(16-20(19)15-21)31-13-6-7-14-32-34(28,29)33-23(17-24(26)27)18-25(2,3)4/h8-11,15-16,23H,5-7,12-14,17-18H2,1-4H3,(H-,26,27,28,29)/p+1/t23-/m1/s1 |
| InChIKey | XBUVAPBVBMIXKA-HSZRJFAPSA-O |
| XLogP | 4.47 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|