C23H41NO7P+ — CID 15228447
[(2R)-3-carboxy-2-[8-(3,4-dimethylphenoxy)octoxy-hydroxyphosphoryl]oxypropyl]-trimethylazanium (PubChem CID 15228447) has the molecular formula C23H41NO7P+ and a molecular weight of 474.56 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[8-(3,4-dimethylphenoxy)octoxy-hydroxyphosphoryl]oxypropyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-2-[8-(3,4-dimethylphenoxy)octoxy-hydroxyphosphoryl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 15228447 |
| Molecular Formula | C23H41NO7P+ |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | [(2R)-3-carboxy-2-[8-(3,4-dimethylphenoxy)octoxy-hydroxyphosphoryl]oxypropyl]-trimethylazanium |
| SMILES | Cc1ccc(OCCCCCCCCOP(=O)(O)O[C@H](CC(=O)O)C[N+](C)(C)C)cc1C |
| InChI | InChI=1S/C23H40NO7P/c1-19-12-13-21(16-20(19)2)29-14-10-8-6-7-9-11-15-30-32(27,28)31-22(17-23(25)26)18-24(3,4)5/h12-13,16,22H,6-11,14-15,17-18H2,1-5H3,(H-,25,26,27,28)/p+1/t22-/m1/s1 |
| InChIKey | OZAYKKIYXYQCPB-JOCHJYFZSA-O |
| XLogP | 4.71 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|