C22H39NO6PS2+ — CID 54545378
[(2R)-3-carboxy-2-[4-(3-pentoxyphenoxy)butoxy-sulfanylphosphinothioyl]oxypropyl]-trimethylazanium (PubChem CID 54545378) has the molecular formula C22H39NO6PS2+ and a molecular weight of 508.66 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[4-(3-pentoxyphenoxy)butoxy-sulfanylphosphinothioyl]oxypropyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-2-[4-(3-pentoxyphenoxy)butoxy-sulfanylphosphinothioyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 54545378 |
| Molecular Formula | C22H39NO6PS2+ |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | [(2R)-3-carboxy-2-[4-(3-pentoxyphenoxy)butoxy-sulfanylphosphinothioyl]oxypropyl]-trimethylazanium |
| SMILES | CCCCCOc1cccc(OCCCCOP(=S)(S)O[C@H](CC(=O)O)C[N+](C)(C)C)c1 |
| InChI | InChI=1S/C22H38NO6PS2/c1-5-6-7-13-26-19-11-10-12-20(16-19)27-14-8-9-15-28-30(31,32)29-21(17-22(24)25)18-23(2,3)4/h10-12,16,21H,5-9,13-15,17-18H2,1-4H3,(H-,24,25,31,32)/p+1/t21-/m1/s1 |
| InChIKey | ZGEBKPZKXDDIKR-OAQYLSRUSA-O |
| XLogP | 5.15 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|