C21H38NO9P — CID 22407864
[2-[4-(3-butoxyphenoxy)butoxy-hydroxyphosphoryl]oxy-3-carboxypropyl]-trimethylazanium hydroxide (PubChem CID 22407864) has the molecular formula C21H38NO9P and a molecular weight of 479.51 g/mol. Its IUPAC name is [2-[4-(3-butoxyphenoxy)butoxy-hydroxyphosphoryl]oxy-3-carboxypropyl]-trimethylazanium hydroxide.
| Compound Name | [2-[4-(3-butoxyphenoxy)butoxy-hydroxyphosphoryl]oxy-3-carboxypropyl]-trimethylazanium hydroxide |
|---|---|
| PubChem CID | 22407864 |
| Molecular Formula | C21H38NO9P |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | [2-[4-(3-butoxyphenoxy)butoxy-hydroxyphosphoryl]oxy-3-carboxypropyl]-trimethylazanium hydroxide |
| SMILES | CCCCOc1cccc(OCCCCOP(=O)(O)OC(CC(=O)O)C[N+](C)(C)C)c1.[OH-] |
| InChI | InChI=1S/C21H36NO8P.H2O/c1-5-6-12-27-18-10-9-11-19(15-18)28-13-7-8-14-29-31(25,26)30-20(16-21(23)24)17-22(2,3)4;/h9-11,15,20H,5-8,12-14,16-17H2,1-4H3,(H-,23,24,25,26);1H2 |
| InChIKey | BCWCOKMIDSJNBC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|