C23H42NO9P — CID 67736603
[(2R)-3-carboxy-2-[hydroxy-[4-(3-methyl-5-pentoxyphenoxy)butoxy]phosphoryl]oxypropyl]-trimethylazanium hydroxide (PubChem CID 67736603) has the molecular formula C23H42NO9P and a molecular weight of 507.56 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[hydroxy-[4-(3-methyl-5-pentoxyphenoxy)butoxy]phosphoryl]oxypropyl]-trimethylazanium hydroxide.
| Compound Name | [(2R)-3-carboxy-2-[hydroxy-[4-(3-methyl-5-pentoxyphenoxy)butoxy]phosphoryl]oxypropyl]-trimethylazanium hydroxide |
|---|---|
| PubChem CID | 67736603 |
| Molecular Formula | C23H42NO9P |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | [(2R)-3-carboxy-2-[hydroxy-[4-(3-methyl-5-pentoxyphenoxy)butoxy]phosphoryl]oxypropyl]-trimethylazanium hydroxide |
| SMILES | CCCCCOc1cc(C)cc(OCCCCOP(=O)(O)O[C@H](CC(=O)O)C[N+](C)(C)C)c1.[OH-] |
| InChI | InChI=1S/C23H40NO8P.H2O/c1-6-7-8-11-29-20-14-19(2)15-21(16-20)30-12-9-10-13-31-33(27,28)32-22(17-23(25)26)18-24(3,4)5;/h14-16,22H,6-13,17-18H2,1-5H3,(H-,25,26,27,28);1H2/t22-;/m1./s1 |
| InChIKey | BNGNVDBTXDTRKV-VZYDHVRKSA-N |
| XLogP | 4.23 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|