C21H37ClNO8P — CID 67736692
[(2R)-3-carboxy-2-[8-(3-chlorophenoxy)octoxy-hydroxyphosphoryl]oxypropyl]-trimethylazanium hydroxide (PubChem CID 67736692) has the molecular formula C21H37ClNO8P and a molecular weight of 497.95 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[8-(3-chlorophenoxy)octoxy-hydroxyphosphoryl]oxypropyl]-trimethylazanium hydroxide.
| Compound Name | [(2R)-3-carboxy-2-[8-(3-chlorophenoxy)octoxy-hydroxyphosphoryl]oxypropyl]-trimethylazanium hydroxide |
|---|---|
| PubChem CID | 67736692 |
| Molecular Formula | C21H37ClNO8P |
| Molecular Weight | 497.95 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | [(2R)-3-carboxy-2-[8-(3-chlorophenoxy)octoxy-hydroxyphosphoryl]oxypropyl]-trimethylazanium hydroxide |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)O)OP(=O)(O)OCCCCCCCCOc1cccc(Cl)c1.[OH-] |
| InChI | InChI=1S/C21H35ClNO7P.H2O/c1-23(2,3)17-20(16-21(24)25)30-31(26,27)29-14-9-7-5-4-6-8-13-28-19-12-10-11-18(22)15-19;/h10-12,15,20H,4-9,13-14,16-17H2,1-3H3,(H-,24,25,26,27);1H2/t20-;/m1./s1 |
| InChIKey | YFIFILDAAQAECJ-VEIFNGETSA-N |
| XLogP | 4.57 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.95 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|