C23H33NO8P+ — CID 67736792
[(2R)-3-carboxy-1-hydroxy-2-[hydroxy-[4-(4-phenoxyphenoxy)butoxy]phosphanyl]oxypropyl]-trimethylazanium (PubChem CID 67736792) has the molecular formula C23H33NO8P+ and a molecular weight of 482.49 g/mol. Its IUPAC name is [(2R)-3-carboxy-1-hydroxy-2-[hydroxy-[4-(4-phenoxyphenoxy)butoxy]phosphanyl]oxypropyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-1-hydroxy-2-[hydroxy-[4-(4-phenoxyphenoxy)butoxy]phosphanyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 67736792 |
| Molecular Formula | C23H33NO8P+ |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | [(2R)-3-carboxy-1-hydroxy-2-[hydroxy-[4-(4-phenoxyphenoxy)butoxy]phosphanyl]oxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)C(O)[C@@H](CC(=O)O)OP(O)OCCCCOc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H32NO8P/c1-24(2,3)23(27)21(17-22(25)26)32-33(28)30-16-8-7-15-29-18-11-13-20(14-12-18)31-19-9-5-4-6-10-19/h4-6,9-14,21,23,27-28H,7-8,15-17H2,1-3H3/p+1/t21-,23?,33?/m1/s1 |
| InChIKey | NJUBCYQROHLLCJ-QHCNGOCISA-O |
| XLogP | 3.76 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|