C25H44NO8P — CID 67736596
(2R)-2-[8-(4-tert-butylphenoxy)octoxy-hydroxyphosphoryl]oxy-4-hydroxy-4-oxo-1-(trimethylazaniumyl)butan-1-olate (PubChem CID 67736596) has the molecular formula C25H44NO8P and a molecular weight of 517.60 g/mol. Its IUPAC name is (2R)-2-[8-(4-tert-butylphenoxy)octoxy-hydroxyphosphoryl]oxy-4-hydroxy-4-oxo-1-(trimethylazaniumyl)butan-1-olate.
| Compound Name | (2R)-2-[8-(4-tert-butylphenoxy)octoxy-hydroxyphosphoryl]oxy-4-hydroxy-4-oxo-1-(trimethylazaniumyl)butan-1-olate |
|---|---|
| PubChem CID | 67736596 |
| Molecular Formula | C25H44NO8P |
| Molecular Weight | 517.60 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | (2R)-2-[8-(4-tert-butylphenoxy)octoxy-hydroxyphosphoryl]oxy-4-hydroxy-4-oxo-1-(trimethylazaniumyl)butan-1-olate |
| SMILES | CC(C)(C)c1ccc(OCCCCCCCCOP(=O)(O)O[C@H](CC(=O)O)C([O-])[N+](C)(C)C)cc1 |
| InChI | InChI=1S/C25H44NO8P/c1-25(2,3)20-13-15-21(16-14-20)32-17-11-9-7-8-10-12-18-33-35(30,31)34-22(19-23(27)28)24(29)26(4,5)6/h13-16,22,24H,7-12,17-19H2,1-6H3,(H,27,28)(H,30,31)/t22-,24?/m1/s1 |
| InChIKey | UGNSBSBTNMNGMU-LETIRJCYSA-N |
| XLogP | 4.07 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.60 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|