C26H45N3O5 — CID 59294401
(3R)-3-[[5-(3-hexoxyphenoxy)pentyl-methylcarbamoyl]amino]-4-(trimethylazaniumyl)butanoate (PubChem CID 59294401) has the molecular formula C26H45N3O5 and a molecular weight of 479.66 g/mol. Its IUPAC name is (3R)-3-[[5-(3-hexoxyphenoxy)pentyl-methylcarbamoyl]amino]-4-(trimethylazaniumyl)butanoate.
| Compound Name | (3R)-3-[[5-(3-hexoxyphenoxy)pentyl-methylcarbamoyl]amino]-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 59294401 |
| Molecular Formula | C26H45N3O5 |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.34 |
| IUPAC Name | (3R)-3-[[5-(3-hexoxyphenoxy)pentyl-methylcarbamoyl]amino]-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCCCCOc1cccc(OCCCCCN(C)C(=O)N[C@H](CC(=O)[O-])C[N+](C)(C)C)c1 |
| InChI | InChI=1S/C26H45N3O5/c1-6-7-8-11-17-33-23-14-13-15-24(20-23)34-18-12-9-10-16-28(2)26(32)27-22(19-25(30)31)21-29(3,4)5/h13-15,20,22H,6-12,16-19,21H2,1-5H3,(H-,27,30,31,32)/t22-/m1/s1 |
| InChIKey | MFPYLBKJMCFXBO-JOCHJYFZSA-N |
| XLogP | 3.05 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|